Answer:
9x⁻² is not a polynomial
Step-by-step explanation:
A polynomial function is a function that involves non-negative integer powers of x such as a quadratic, cubic etc.
A polynomial is a function written in the form of ;
f{x} =aₙxⁿ+aₙ₋₁xⁿ⁻¹+-------+a₂x²+a₁x+a₀
The degree of a polynomial is the highest power of x in the expression
9x⁻² ----in this case, the power is negative thus this is not a polynomial.
Answer:
Not a polynomial
Step-by-step explanation:
What is the interval notation for the compound inequality? x≤−4 or x≥5
(−∞, −4) or (5, ∞)
(−∞, −4] or [5, ∞)
(−4,5)
[−4,5]
Answer:
(-∞, -4] or [5, ∞)
Step-by-step explanation:
Because the solutions for x can also be equal to -4 and 5, brackets are used.
And because the solutions for x can be any number less than -4 or any number greater than 5, -∞ and ∞ are used respectively.
Kira is on her way home in her car. Her drive is 30 miles long. She has finished one-third of the drive so far. How far has she driven?
Answer:
10 miles
Step-by-step explanation:
1/3 × 30 miles = 10 miles
Answer:
Step-by-step explanation:
30 * 1/3 = 10 :)
Have no idea how to do this lok
Answer:
that hard
Step-by-step explanation:
What is the solution to the system below?
y = -3x - 2
6x + 2y = -4
Answer:
Infinitely many solutions
Step-by-step explanation:
Since y=-3x-2, plug it in (2)
6x+2(-3x-2)=-4.
Distribute:
6x-6x-4=-4
-4=-4
Infinetly many solutions.
Hope this helps :)
think of an event that might occur at three different speeds and describe it.
Answer:
tornado!
Step-by-step explanation:
sometimes tornados can start off slow and sometimes they can go really fast.
it takes 12 people to pull 30 tons of goods how many people would it take to pull 60 tons of goods
Answer:
24
Step-by-step explanation:
60 is double of 30 so double 12 to get your answer, 12 time two is 24
PLEASE HELPP
What is the solution to the following system of equations?
x − 3y = 6
2x + 2y = 4
(-1, 3)
(3, -1)
(1, -3)
(-3, 1)
Answer:
The solution to the system of equations be:
[tex]x=3,\:y=-1[/tex]
Hece, option B is correct.
Step-by-step explanation:
Given the system of equations
[tex]\begin{bmatrix}x-3y=6\\ 2x+2y=4\end{bmatrix}[/tex]
Multiply x − 3y = 6 by 2: 2x-6y=12
[tex]\begin{bmatrix}2x-6y=12\\ 2x+2y=4\end{bmatrix}[/tex]
so
[tex]2x+2y=4[/tex]
[tex]-[/tex]
[tex]\underline{2x-6y=12}[/tex]
[tex]8y=-8[/tex]
so the system of equations becomes
[tex]\begin{bmatrix}2x-6y=12\\ 8y=-8\end{bmatrix}[/tex]
Solve 8y = -8 for y
[tex]8y=-8[/tex]
Divide both sides by 8
[tex]\frac{8y}{8}=\frac{-8}{8}[/tex]
[tex]y=-1[/tex]
[tex]\mathrm{For\:}2x-6y=12\mathrm{\:plug\:in\:}y=-1[/tex]
[tex]2x-6\left(-1\right)=12[/tex]
[tex]2x+6=12[/tex]
subtract 6 from both sides
[tex]2x+6-6=12-6[/tex]
[tex]2x=6[/tex]
Divide both sides by 2
[tex]\frac{2x}{2}=\frac{6}{2}[/tex]
[tex]x=3[/tex]
Therefore, the solution to the system of equations be:
[tex]x=3,\:y=-1[/tex]
Hence, option B is correct.
⚽ From Equation (i) we get :
x = 6 + 3y......[Equation (iii)]⚽ Now, Substitute the equation (iii) in equation (ii) we get :
→ 2(6 + 3y) + 2y = 4
→ 12 + 6y + 2y = 4
→ 8y = 4 - 12
→ 8y = -8
→ y = -8 ÷ 8
→ y = -1
⚽ Now Substituting value of y = -1 in equation (iii) we get :
→ x = 6 + 3y
→ x = 6 + 3(-1)
→ x = 6 + (-3)
→ x = 6 - 3
→ x = 3
Hence,the value of x = 3 and value of y = -1.Express 0.000000000936 in
scientific notation.
9.36x10
Enter
Answer:
9.36 x 10^(-10)
Step-by-step explanation:
PLEASE HELP
f(x) = x2. What is g(x)?
Answer: Choice C. g(x) = (3x)^2
To confirm this, plug in x = 1 and you'll find that:
g(x) = (3x)^2
g(1) = (3*1)^2
g(1) = (3)^2
g(1) = 3*3
g(1) = 9
Showing that (1,9) is on the red g(x) curve.
Round 3292.53429 to the nearest hundred thousandth
Answer:
The answer is "0.00001"
Step-by-step explanation:
Given value:
[tex]\to 3292.53429[/tex]
when we round a hundred thousandths (100,000) value. So, the given rounding 3292.53429 to the nearest 0.00001.
Explain it too and is it x method?
A line is perpendicular to y = 3x - 8
and intersects the point (2,2).
What is the equation of this
perpendicular line?
Since the line is perpendicular, we know that the slope is reciprocal and negative to the other one.
So,
y = -4x + b
We want to find the y-intersect (b) so substitute the intersected points and solve for it.
2 = -4(2) + b
2 = -8 + b
2 + 8 = b
10 = b
So the complete equation would be:
y = -4x + 10
3/7 to its decimal form and rounded to the nearest thousandth
Answer:
Decimal form: 0.4286
Step-by-step explanation:
The value of 3/7 in decimal form up to nearest thousands will be 0.4285.
A fraction 3/7 is given in the question.
We have to find it's decimal form and round-off it to nearest thousands.
What will be the value of 1/2 in decimal form rounded to units place ?
The value will be 0.5
To find the decimal form let's divide 3 by 7.
3 ÷ 7 = 0.428572
We have to round it to nearest thousands i.e., up to 4 places Right to decimal point.
The rounded value will be 0.4285.
thus , the decimal form of 3/7 will be 0.4285 rounded off to nearest thousands.
To learn more about how to convert fraction to decimal click here ;
https://brainly.com/question/13635105
#SPJ2
A ball is thrown upward at an angle of 30° to the horizontal and lands on the top edge of a building that is 20 m away. The top edge is 5.0 m above the throwing point. How fast was the ball thrown? Use: sin30°=0.5 and cos30°=0.9
a. 20 m/s
b. 11 m/s
c. 52.3 m/s
d. 16 m/s
Answer:
The correct option is;
a. 20 m/s
Step-by-step explanation:
The given parameters are;
The angle at which the ball is thrown, θ = 30° to the horizontal
The horizontal distance of the top edge of the building where the ball lands from where the ball is thrown, x = 20 m
The height of the top edge of the building above the throwing point = 5 meters
Let "v" represent the speed with which the ball is thrown
We have;
The vertical component of the speed with which the ball is thrown, [tex]v_y[/tex] = v × sin(θ) = v × sin(30°) = v × 0.5 = 0.5·v
[tex]v_y[/tex] = 0.5·v
The horizontal component of the speed with which the ball is thrown, vₓ = v × cos(θ) = v × cos(30°) = v × 0.9 = 0.9·v
vₓ = 0.9·v
The kinematic equation of the motion is y = [tex]v_y[/tex]·t - (1/2)·g·t², where;
y = The vertical height reached = 5 metes
t = The time taken to reach the specified 5 m, height
g = The acceleration due to gravity = 9.8 m/s², we have;
Therefore, we have;
5 = 0.5·v·t - (1/2)·9.8·t²...(1)
Also, from the horizontal motion of the ball, we have the following kinematic equation of motion;
x = vₓ × t
Therefore, by substituting the known values, we have;
20 = 0.9·v × t
∴ v = 20/(0.9·t) = 200/(9·t)...(2)
Substituting the value of t in equation (1) gives;
5 = 0.5·v·t - (1/2)·9.8·t² = 0.5·(200/(9·t))·t - (1/2)·9.8·t²
∴ 5 = 0.5·(200/(9·t))·t - (1/2)·9.8·t² = 100/9 - 4.9·t²
4.9·t² = 100/9 - 5 = 55/9
t = √(55/(9 × 4.9)) ≈ 1.116766
The time taken to reach the specified 5 m height = t ≈ 1.116766 seconds
From equation (2), we have, v = 200/(9·t) = 200/(9 × 1.116766) ≈ 19.8987 m/s
The speed with which the ball is thrown = v ≈ 19.8987 m/s ≈ 20 m/s. to the nearest whole number.
The speed with which the ball is thrown is approximately 20 m/s
Answer:
The answer is:
a) 20 m/s
Hope it helps:D
the diagram shows two parallel lines cut by a transversal. If the measure of < 3 = ( 7y + 15) and the measure of < 5 = ( 110 - 2y) , what is the measure of <4
Step-by-step explanation:
Angle 3 + Angle 5 = 180° (C-angles)
Therefore 7y + 15 + 110 - 2y = 180, 5y = 55, y = 11.
Angle 4 = Angle 5 (Z-angles)
Hence Angle 4 = 110 - 2y = 110 - 2(11) = 88°.
What is the expression shown
Answer:
There is nothing but your question and you should try on your own
Step-by-step explanation:
Answer:
N/A
Step-by-step explanation:
There is not context with this problem, therefore it cannot be solved.
|-4/5-1/10| + |-3/4+5/2|
A.) 9/10
B.) 53/20
C.) 7/4
D.) 17/10
Answer:
B.) 53/20
General Formulas and Concepts:
Pre-Algebra
Order of Operations: BPEMDAS
Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to RightAlgebra I
|Absolute Value| makes any negative number positiveStep-by-step explanation:
Step 1: Define
|-4/5 - 1/10| + |-3/4 + 5/2|
Step 2: Evaluate
Subtract: |-9/10| + |-3/4 + 5/2|Add: |-9/10| + |7/4|Absolute Value: 9/10 + 7/4Add: 53/20TRAVEL It is about 350 miles from Ruidoso, New Mexico, to Abilene, Texas. Haruko has already driven 75 miles and made it to Roswell, New Mexico. She hopes to finish the rest of her trip, including stops, in 5 hours. Write an equation to find the average speed Haruko needs to drive to finish the rest of her trip in 5 hours.
Answer:
55 mph
Step-by-step explanation:
Given that:
Total miles of journey = 350 miles
Miles already driven = 75 miles
To cover the rest of the journey in 5 hours, the average speed of travel. Will be:
Recall:
Speed = (Distance left to cover ÷ budgeted travel time)
Distance left to cover : (total miles - distance already driven)
Average speed required = (350 - 75) / 5
= 275 / 5
= 55 mph
1) Graph the quadratic function given in standard form and identify the key features. Include at least 5 points on your
graph.
y=-x²-2x +1
Axis of Symmetry:
Vertex:
Y-intercept:
Domain:
Range:
Just question one plz help ASAP
Answer:
14
Step-by-step explanation:
Answer Plz, ASAP. Within 10 minutes will be Marked as Brainliest
[tex] \sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=?[/tex]
[tex]\large\bold{\underline{\underline{Explanation:-}}}[/tex]They are asking us to find the determinant
[tex]\boxed{\sf \left|\begin{array}{c c} a & b \\ c & d \end{array}\right| =ad-bc}[/tex]
Now using the above formula it becomes[tex]\left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right| \: = sin20 \degree cos70 \degree - ( - cos20 \degree sin70 \degree) \: \\ \\ = sin20 \degree cos70 \degree + cos20 \degree sin70 \degree [/tex]
Now using the formula[tex]\boxed{\sf sin(A+B)=sinAcosB+cosAsinB}[/tex]
it becomes
[tex] \longrightarrow \: sin(20 + 70) \\ \\ \longrightarrow \: sin(90 \degree) = 1[/tex]
★Therefore[tex] \boxed{\sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=1}[/tex]
━━━━━━━━━━━━━━━━━━━★Extra information:-What is a matrix?☄It is a rectangular representation or array of numbers,symbols and many more functions
☄It is represented in rows and columns
━━━━━━━━━━━━━━━━━━━━━━━━━━Line A passes through points (2, 9) and (7, 3). Line B passes through points (1, 4) and (7, 9). Are line A and line B parallel or perpendicular?
Rewrite in simplest terms: (10x + y) + (10x – 7y)
Oh
9514 1404 393
Answer:
20x -6y
Step-by-step explanation:
Parentheses can be eliminated and like terms combined.
10x +y +10x -7y
= x(10 +10) +y(1 -7)
= 20x -6y
Here are two rectangles.
Complete this sentence:
The two rectangles are similar and the scale factor is __
Answer:
It is
Scale Factor = Ratio of Side Lengths
= 12/8 = 9/6 = 1.5.
Step-by-step explanation:
Hope this helped have an amazing day!
The two rectangles are similar and the scale factor is 3/2.
Given data:
The first rectangle is represented as ABCD
The second rectangle is represented as PQRS
Now, the dimensions of ABCD is 8 cm x 6 cm
The dimensions of PQRS is 12 cm x 9 cm
So, the scale factor is represented as k and the value of k is :
k = length of PQRS / length of ABCD
So, k = 12 / 8
k = 3/2
Hence , the similar rectangles have a scale factor of 3/2
To learn more about rectangle click :
https://brainly.com/question/15225905
#SPJ2
A classroom is 11 m long, 8 m wide and 5.5 m high Find the sum of the areas of the four walls.
( please show the working out pleaseee)
Answer:
209 m²
Step-by-step explanation:
The class room has a measurement of 11 m long, 8 m wide and 5.5 m high. Hence the walls of the classroom would be 4, with the following measurements.
Wall 1: 11 m by 5.5 m, Wall 2: 8 m by 5.5 m, Wall 3: 11 m by 5.5 m and Wall 4: 8 m by 5.5 m
The area of wall 1 = 11 m * 5.5 m = 60.5 m²
The area of wall 2 = 8 m * 5.5 m = 44 m²
The area of wall 3 = 11 m * 5.5 m = 60.5 m²
The area of wall 4 = 11 m * 5.5 m = 44 m²
The sum of areas of the fall wall = area of wall 1 + area of wall 2 + area of wall 3 + area of wall 4
The sum of areas of the fall wall = 60.5 + 44 + 60.5 + 44 = 209 m²
Express 27 4/3 in simplest radical form
Answer:
3⁴
Step-by-step explanation:
Expressing in the simplest radical form means simplifying a radical so that there are no more square roots, cube roots, fourth roots etc.
It further means removing radicals in the denominator of a fraction.
Given
[tex]27^{4/3}[/tex]
this can be written as
[tex](\sqrt[3]{27} )^{4}[/tex]
This is simplified as;
(3)⁴
BC = 17.89
DC = 16
with reference to the figure sin x=?
a.0.250
b. 0.447
c.0.894
d. 1
Answer:
c
Step-by-step explanation:
The value of sin x in the given right triangle is 0.894.
What sine of an angle?The sine of an angle is a trigonometric function that is defined as the ratio of the length of the side opposite the angle to the length of the hypotenuse in a right triangle.
Given is right triangle ABC, we need to find the value of sin x,
So, we see that the figure is divided into three similar triangles,
Namely,
Δ CDB ~ Δ BDA ~ Δ CBA,
Therefore, according to the definition of similarity,
We have,
CD / CB = BD / BA = 16/17.89
Therefore, BD / BA = 0.894
Also,
sin x = BD / BA
Therefore,
sin x = 0.894
Hence the value of sin x in the given right triangle is 0.894.
Learn more about sine of an angle, click;
https://brainly.com/question/3827723
#SPJ7
Help me on this math problem please! I’ve been stuck on it for 15 mins now
Answer:
Step-by-step explanation:
P = perimeter = 114
P =2 * length +2* width
P = 2(2x - 3) + 2(x)
114 = 4x-6 + 2x
114 = 6x -6
19 = x -1
20 = x
check it
2( 2x -3)+2x = ?
4x -6 +2x=?
6x -6 = ?
6(20)-6 =?
120-6 = 114
yep this is correct
In the figure, point C is the midpoint of (A/E) Use the figure to answer the questions.
Avery says that AbC /DeC by the ASA congruence postulate. Do you agree or disagree Explain?
Suppose it is also known that point C is also the midpoint of (B/D Which postulate or theorem can be used to prove that aBC/DeC? Justify your answer.
Answer:
Disagree ΔABC ≅ ΔDEC by ASA butt by SAS
Step-by-step explanation:
point C is the midpoint of (A/E), C is also the midpoint of (B/D )
BC = CD and AC = CE
∠BCA = ∠ECD
ΔABC ≅ ΔDEC by SAS not by ASA
PLEASE HELP ASSP !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
Answer:
A: 2/9
Step-by-step explanation:
help!!
Find the solution of the system of equations
shown on the graph.
Answer:
(0,6)
Step-by-step explanation:
When a system of equations is graphed, the point at which the lines intersect is a solution to the system. Looking at the graph, we can see that the lines intersect at (0,6). Therefore, (0,6) is a solution to the system of equations.